C18H18N4O3 — CID 17349534
4-N-[(E)-1-(3-acetamidophenyl)ethylideneamino]benzene-1,4-dicarboxamide (PubChem CID 17349534) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is 4-N-[(E)-1-(3-acetamidophenyl)ethylideneamino]benzene-1,4-dicarboxamide.
| Compound Name | 4-N-[(E)-1-(3-acetamidophenyl)ethylideneamino]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 17349534 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 4-N-[(E)-1-(3-acetamidophenyl)ethylideneamino]benzene-1,4-dicarboxamide |
| SMILES | CC(=O)Nc1cccc(/C(C)=N/NC(=O)c2ccc(C(N)=O)cc2)c1 |
| InChI | InChI=1S/C18H18N4O3/c1-11(15-4-3-5-16(10-15)20-12(2)23)21-22-18(25)14-8-6-13(7-9-14)17(19)24/h3-10H,1-2H3,(H2,19,24)(H,20,23)(H,22,25)/b21-11+ |
| InChIKey | GDVPCFYLENGSBO-SRZZPIQSSA-N |
| XLogP | 1.90 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|