C25H48O2Si — CID 173495366
[(1R,3aR,4S,7aR)-1-(6-methoxy-6-methylhept-2-en-2-yl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 173495366) has the molecular formula C25H48O2Si and a molecular weight of 408.74 g/mol. Its IUPAC name is [(1R,3aR,4S,7aR)-1-(6-methoxy-6-methylhept-2-en-2-yl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3aR,4S,7aR)-1-(6-methoxy-6-methylhept-2-en-2-yl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 173495366 |
| Molecular Formula | C25H48O2Si |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | [(1R,3aR,4S,7aR)-1-(6-methoxy-6-methylhept-2-en-2-yl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COC(C)(C)CCC=C(C)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C25H48O2Si/c1-19(13-11-17-24(5,6)26-8)20-15-16-21-22(14-12-18-25(20,21)7)27-28(9,10)23(2,3)4/h13,20-22H,11-12,14-18H2,1-10H3/t20-,21+,22+,25-/m1/s1 |
| InChIKey | KHGYUHPCPWFNDB-HXKBJWFLSA-N |
| XLogP | 7.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|