About (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol
(1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol (PubChem CID 173495442) has the molecular formula C7H7ClO2
and a molecular weight of 158.58 g/mol. Its IUPAC name is (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 173495442 |
| Molecular Formula | C7H7ClO2 |
| Molecular Weight | 158.58 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol |
| SMILES | O/C=C1\C=CC=C(Cl)[C@H]1O |
| InChI | InChI=1S/C7H7ClO2/c8-6-3-1-2-5(4-9)7(6)10/h1-4,7,9-10H/b5-4+/t7-/m0/s1 |
| InChIKey | BAUSAXSEFUCTGN-KPJROHGDSA-N |
| XLogP | 1.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.58 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol?
The IUPAC name of (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol (CID 173495442) is (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol is O/C=C1\C=CC=C(Cl)[C@H]1O.
What is the InChIKey of (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol?
The InChIKey is BAUSAXSEFUCTGN-KPJROHGDSA-N. The full InChI is InChI=1S/C7H7ClO2/c8-6-3-1-2-5(4-9)7(6)10/h1-4,7,9-10H/b5-4+/t7-/m0/s1.
What are the key properties of (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol?
(1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol has a molecular weight of 158.58 g/mol, XLogP of 1.48, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,6E)-2-chloro-6-(hydroxymethylidene)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 173495442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).