C21H28N6O4 — CID 173495615
(4Z)-N-butyl-4-[5-[3-(butylcarbamoyl)-5-oxo-1,2-dihydropyrazol-4-yl]penta-2,4-dienylidene]-5-oxo-1H-pyrazole-3-carboxamide (PubChem CID 173495615) has the molecular formula C21H28N6O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is (4Z)-N-butyl-4-[5-[3-(butylcarbamoyl)-5-oxo-1,2-dihydropyrazol-4-yl]penta-2,4-dienylidene]-5-oxo-1H-pyrazole-3-carboxamide.
| Compound Name | (4Z)-N-butyl-4-[5-[3-(butylcarbamoyl)-5-oxo-1,2-dihydropyrazol-4-yl]penta-2,4-dienylidene]-5-oxo-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 173495615 |
| Molecular Formula | C21H28N6O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | (4Z)-N-butyl-4-[5-[3-(butylcarbamoyl)-5-oxo-1,2-dihydropyrazol-4-yl]penta-2,4-dienylidene]-5-oxo-1H-pyrazole-3-carboxamide |
| SMILES | CCCCNC(=O)C1=NNC(=O)/C1=C\C=CC=Cc1c(C(=O)NCCCC)[nH][nH]c1=O |
| InChI | InChI=1S/C21H28N6O4/c1-3-5-12-22-20(30)16-14(18(28)26-24-16)10-8-7-9-11-15-17(25-27-19(15)29)21(31)23-13-6-4-2/h7-11H,3-6,12-13H2,1-2H3,(H,22,30)(H,23,31)(H,26,28)(H2,25,27,29)/b8-7?,11-9?,14-10- |
| InChIKey | JOGQXMHWIBJWJC-MQCSIVHLSA-N |
| XLogP | 1.13 |
| TPSA | 148.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|