C22H22FN3O3S2 — CID 17349570
4-ethyl-N-[4-[(E)-N-[(4-fluorophenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]-5-methylthiophene-3-carboxamide (PubChem CID 17349570) has the molecular formula C22H22FN3O3S2 and a molecular weight of 459.57 g/mol. Its IUPAC name is 4-ethyl-N-[4-[(E)-N-[(4-fluorophenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]-5-methylthiophene-3-carboxamide.
| Compound Name | 4-ethyl-N-[4-[(E)-N-[(4-fluorophenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]-5-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 17349570 |
| Molecular Formula | C22H22FN3O3S2 |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 4-ethyl-N-[4-[(E)-N-[(4-fluorophenyl)sulfonylamino]-C-methylcarbonimidoyl]phenyl]-5-methylthiophene-3-carboxamide |
| SMILES | CCc1c(C(=O)Nc2ccc(/C(C)=N/NS(=O)(=O)c3ccc(F)cc3)cc2)csc1C |
| InChI | InChI=1S/C22H22FN3O3S2/c1-4-20-15(3)30-13-21(20)22(27)24-18-9-5-16(6-10-18)14(2)25-26-31(28,29)19-11-7-17(23)8-12-19/h5-13,26H,4H2,1-3H3,(H,24,27)/b25-14+ |
| InChIKey | WYOPSQYNOJPTIY-AFUMVMLFSA-N |
| XLogP | 4.71 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|