C18H24FN5 — CID 173495770
5-(4-fluorophenyl)-4-(C-piperidin-4-ylcarbonohydrazonoyl)hexa-1,3,5-triene-1,3-diamine (PubChem CID 173495770) has the molecular formula C18H24FN5 and a molecular weight of 329.42 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-(C-piperidin-4-ylcarbonohydrazonoyl)hexa-1,3,5-triene-1,3-diamine.
| Compound Name | 5-(4-fluorophenyl)-4-(C-piperidin-4-ylcarbonohydrazonoyl)hexa-1,3,5-triene-1,3-diamine |
|---|---|
| PubChem CID | 173495770 |
| Molecular Formula | C18H24FN5 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 5-(4-fluorophenyl)-4-(C-piperidin-4-ylcarbonohydrazonoyl)hexa-1,3,5-triene-1,3-diamine |
| SMILES | C=C(C(C(=NN)C1CCNCC1)=C(N)C=CN)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FN5/c1-12(13-2-4-15(19)5-3-13)17(16(21)6-9-20)18(24-22)14-7-10-23-11-8-14/h2-6,9,14,23H,1,7-8,10-11,20-22H2 |
| InChIKey | ORVSANICJPTKLD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_enamin(30)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|