About 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene
1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene (PubChem CID 173495774) has the molecular formula C14H19F
and a molecular weight of 206.30 g/mol. Its IUPAC name is 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene |
| PubChem CID | 173495774 |
| Molecular Formula | C14H19F |
| Molecular Weight | 206.30 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene |
| SMILES | C/C=C(\C=C/CC)CC1=CC=C(F)CC1 |
| InChI | InChI=1S/C14H19F/c1-3-5-6-12(4-2)11-13-7-9-14(15)10-8-13/h4-7,9H,3,8,10-11H2,1-2H3/b6-5-,12-4+ |
| InChIKey | IYLDMUCFVIDUFM-JWUPWDRQSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.30 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene?
The IUPAC name of 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene (CID 173495774) is 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene.
What is the SMILES notation for 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene?
The canonical SMILES for 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene is C/C=C(\C=C/CC)CC1=CC=C(F)CC1.
What is the InChIKey of 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene?
The InChIKey is IYLDMUCFVIDUFM-JWUPWDRQSA-N. The full InChI is InChI=1S/C14H19F/c1-3-5-6-12(4-2)11-13-7-9-14(15)10-8-13/h4-7,9H,3,8,10-11H2,1-2H3/b6-5-,12-4+.
What are the key properties of 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene?
1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene has a molecular weight of 206.30 g/mol, XLogP of 4.86, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z,2Z)-2-ethylidenehex-3-enyl]-4-fluorocyclohexa-1,3-diene is sourced from PubChem (CID 173495774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).