C12H17N5O5 — CID 173496028
(3S,5R,7S)-7-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxepane-3,4,5-triol (PubChem CID 173496028) has the molecular formula C12H17N5O5 and a molecular weight of 311.30 g/mol. Its IUPAC name is (3S,5R,7S)-7-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxepane-3,4,5-triol.
| Compound Name | (3S,5R,7S)-7-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxepane-3,4,5-triol |
|---|---|
| PubChem CID | 173496028 |
| Molecular Formula | C12H17N5O5 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (3S,5R,7S)-7-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxepane-3,4,5-triol |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1C[C@@H](O)C(O)[C@H](O)C(CO)O1 |
| InChI | InChI=1S/C12H17N5O5/c13-11-8-12(15-3-14-11)17(4-16-8)7-1-5(19)9(20)10(21)6(2-18)22-7/h3-7,9-10,18-21H,1-2H2,(H2,13,14,15)/t5-,6?,7+,9?,10-/m1/s1 |
| InChIKey | XQDRDUGOLGGNPT-CLOBQRCFSA-N |
| XLogP | -2.23 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |