C20H23N3O6S — CID 17349606
N-(3-methylphenyl)-2-[(4-nitrophenyl)sulfonyl-(oxolan-2-ylmethyl)amino]acetamide (PubChem CID 17349606) has the molecular formula C20H23N3O6S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[(4-nitrophenyl)sulfonyl-(oxolan-2-ylmethyl)amino]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[(4-nitrophenyl)sulfonyl-(oxolan-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 17349606 |
| Molecular Formula | C20H23N3O6S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-(3-methylphenyl)-2-[(4-nitrophenyl)sulfonyl-(oxolan-2-ylmethyl)amino]acetamide |
| SMILES | Cc1cccc(NC(=O)CN(CC2CCCO2)S(=O)(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C20H23N3O6S/c1-15-4-2-5-16(12-15)21-20(24)14-22(13-18-6-3-11-29-18)30(27,28)19-9-7-17(8-10-19)23(25)26/h2,4-5,7-10,12,18H,3,6,11,13-14H2,1H3,(H,21,24) |
| InChIKey | FVGRMCJDHOKXHU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|