C2H3N5O2 — CID 173496901
N-(3,4-dihydro-1,2,4-triazol-5-ylidene)nitramide (PubChem CID 173496901) has the molecular formula C2H3N5O2 and a molecular weight of 129.08 g/mol. Its IUPAC name is N-(3,4-dihydro-1,2,4-triazol-5-ylidene)nitramide.
| Compound Name | N-(3,4-dihydro-1,2,4-triazol-5-ylidene)nitramide |
|---|---|
| PubChem CID | 173496901 |
| Molecular Formula | C2H3N5O2 |
| Molecular Weight | 129.08 g/mol |
| Exact Mass | 129.03 |
| IUPAC Name | N-(3,4-dihydro-1,2,4-triazol-5-ylidene)nitramide |
| SMILES | O=[N+]([O-])N=C1N=NCN1 |
| InChI | InChI=1S/C2H3N5O2/c8-7(9)6-2-3-1-4-5-2/h1H2,(H,3,6) |
| InChIKey | NYVBDMLZRXWUEY-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 92.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.08 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|