C14H15N5O2 — CID 173497144
N-[(Z)-3-[5-[(4-hydroxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]prop-2-enimidoyl]acetamide (PubChem CID 173497144) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is N-[(Z)-3-[5-[(4-hydroxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]prop-2-enimidoyl]acetamide.
| Compound Name | N-[(Z)-3-[5-[(4-hydroxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]prop-2-enimidoyl]acetamide |
|---|---|
| PubChem CID | 173497144 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-[(Z)-3-[5-[(4-hydroxyphenyl)methyl]-1H-1,2,4-triazol-3-yl]prop-2-enimidoyl]acetamide |
| SMILES | [H]/N=C(/C=C\c1n[nH]c(Cc2ccc(O)cc2)n1)NC(C)=O |
| InChI | InChI=1S/C14H15N5O2/c1-9(20)16-12(15)6-7-13-17-14(19-18-13)8-10-2-4-11(21)5-3-10/h2-7,21H,8H2,1H3,(H2,15,16,20)(H,17,18,19)/b7-6- |
| InChIKey | STTULKZQPJMLIS-SREVYHEPSA-N |
| XLogP | 1.23 |
| TPSA | 114.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|