C24H25F2N7OS — CID 173497636
N-[4-[4-(azetidin-1-yl)-6-(1,3-diaminobutylideneamino)pyrimidin-2-yl]sulfanylphenyl]-2,5-difluorobenzamide (PubChem CID 173497636) has the molecular formula C24H25F2N7OS and a molecular weight of 497.58 g/mol. Its IUPAC name is N-[4-[4-(azetidin-1-yl)-6-(1,3-diaminobutylideneamino)pyrimidin-2-yl]sulfanylphenyl]-2,5-difluorobenzamide.
| Compound Name | N-[4-[4-(azetidin-1-yl)-6-(1,3-diaminobutylideneamino)pyrimidin-2-yl]sulfanylphenyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 173497636 |
| Molecular Formula | C24H25F2N7OS |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | N-[4-[4-(azetidin-1-yl)-6-(1,3-diaminobutylideneamino)pyrimidin-2-yl]sulfanylphenyl]-2,5-difluorobenzamide |
| SMILES | CC(N)CC(N)=Nc1cc(N2CCC2)nc(Sc2ccc(NC(=O)c3cc(F)ccc3F)cc2)n1 |
| InChI | InChI=1S/C24H25F2N7OS/c1-14(27)11-20(28)30-21-13-22(33-9-2-10-33)32-24(31-21)35-17-6-4-16(5-7-17)29-23(34)18-12-15(25)3-8-19(18)26/h3-8,12-14H,2,9-11,27H2,1H3,(H,29,34)(H2,28,30,31,32) |
| InChIKey | YKCPJJPISQQORO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|