About 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine
2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine (PubChem CID 173497896) has the molecular formula C12H25NS
and a molecular weight of 215.41 g/mol. Its IUPAC name is 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine.
Molecular Properties
| Compound Name | 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine |
| PubChem CID | 173497896 |
| Molecular Formula | C12H25NS |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine |
| SMILES | CC/C(=C\C(C)C(C)(C)C)SCCN |
| InChI | InChI=1S/C12H25NS/c1-6-11(14-8-7-13)9-10(2)12(3,4)5/h9-10H,6-8,13H2,1-5H3/b11-9+ |
| InChIKey | VTWUGWZSJUXORE-PKNBQFBNSA-N |
| XLogP | 3.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine?
The IUPAC name of 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine (CID 173497896) is 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine.
What is the SMILES notation for 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine?
The canonical SMILES for 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine is CC/C(=C\C(C)C(C)(C)C)SCCN.
What is the InChIKey of 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine?
The InChIKey is VTWUGWZSJUXORE-PKNBQFBNSA-N. The full InChI is InChI=1S/C12H25NS/c1-6-11(14-8-7-13)9-10(2)12(3,4)5/h9-10H,6-8,13H2,1-5H3/b11-9+.
What are the key properties of 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine?
2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine has a molecular weight of 215.41 g/mol, XLogP of 3.65, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-5,6,6-trimethylhept-3-en-3-yl]sulfanylethanamine is sourced from PubChem (CID 173497896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).