C11H21N3 — CID 173498315
7-azido-4,4,6,6-tetramethylhept-1-ene (PubChem CID 173498315) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 7-azido-4,4,6,6-tetramethylhept-1-ene.
| Compound Name | 7-azido-4,4,6,6-tetramethylhept-1-ene |
|---|---|
| PubChem CID | 173498315 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 7-azido-4,4,6,6-tetramethylhept-1-ene |
| SMILES | C=CCC(C)(C)CC(C)(C)CN=[N+]=[N-] |
| InChI | InChI=1S/C11H21N3/c1-6-7-10(2,3)8-11(4,5)9-13-14-12/h6H,1,7-9H2,2-5H3 |
| InChIKey | AGCNCLZMLSIZCL-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|