C22H34O5 — CID 173499012
(10E,12E,16E)-3,7,15-trihydroxy-4,10,14,16-tetramethyloctadeca-3,10,12,16-tetraene-2,5-dione (PubChem CID 173499012) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is (10E,12E,16E)-3,7,15-trihydroxy-4,10,14,16-tetramethyloctadeca-3,10,12,16-tetraene-2,5-dione.
| Compound Name | (10E,12E,16E)-3,7,15-trihydroxy-4,10,14,16-tetramethyloctadeca-3,10,12,16-tetraene-2,5-dione |
|---|---|
| PubChem CID | 173499012 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (10E,12E,16E)-3,7,15-trihydroxy-4,10,14,16-tetramethyloctadeca-3,10,12,16-tetraene-2,5-dione |
| SMILES | C/C=C(\C)C(O)C(C)/C=C/C=C(\C)CCC(O)CC(=O)C(C)=C(O)C(C)=O |
| InChI | InChI=1S/C22H34O5/c1-7-15(3)21(26)16(4)10-8-9-14(2)11-12-19(24)13-20(25)17(5)22(27)18(6)23/h7-10,16,19,21,24,26-27H,11-13H2,1-6H3/b10-8+,14-9+,15-7+,22-17? |
| InChIKey | HSMSBVVHEWRTPR-PROHDOQQSA-N |
| XLogP | 3.97 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|