About (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine
(3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine (PubChem CID 173499145) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine.
Molecular Properties
| Compound Name | (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine |
| PubChem CID | 173499145 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine |
| SMILES | C=C/C=C\C(C)=NN1CC=CC=C1C |
| InChI | InChI=1S/C12H16N2/c1-4-5-8-11(2)13-14-10-7-6-9-12(14)3/h4-9H,1,10H2,2-3H3/b8-5-,13-11? |
| InChIKey | BTHGXRPONFDONU-DBIHJRTBSA-N |
| XLogP | 2.88 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine?
The IUPAC name of (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine (CID 173499145) is (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine.
What is the SMILES notation for (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine?
The canonical SMILES for (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine is C=C/C=C\C(C)=NN1CC=CC=C1C.
What is the InChIKey of (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine?
The InChIKey is BTHGXRPONFDONU-DBIHJRTBSA-N. The full InChI is InChI=1S/C12H16N2/c1-4-5-8-11(2)13-14-10-7-6-9-12(14)3/h4-9H,1,10H2,2-3H3/b8-5-,13-11?.
What are the key properties of (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine?
(3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine has a molecular weight of 188.27 g/mol, XLogP of 2.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N-(6-methyl-2H-pyridin-1-yl)hexa-3,5-dien-2-imine is sourced from PubChem (CID 173499145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).