C17H14ClN2O6S4+ — CID 173499379
2-[(2Z)-2-[[5-chloro-3-(sulfomethyl)thieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]-5-methoxy-1,3-benzothiazol-3-yl]acetic acid (PubChem CID 173499379) has the molecular formula C17H14ClN2O6S4+ and a molecular weight of 506.03 g/mol. Its IUPAC name is 2-[(2Z)-2-[[5-chloro-3-(sulfomethyl)thieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]-5-methoxy-1,3-benzothiazol-3-yl]acetic acid.
| Compound Name | 2-[(2Z)-2-[[5-chloro-3-(sulfomethyl)thieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]-5-methoxy-1,3-benzothiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 173499379 |
| Molecular Formula | C17H14ClN2O6S4+ |
| Molecular Weight | 506.03 g/mol |
| Exact Mass | 504.94 |
| IUPAC Name | 2-[(2Z)-2-[[5-chloro-3-(sulfomethyl)thieno[2,3-d][1,3]thiazol-3-ium-2-yl]methylidene]-5-methoxy-1,3-benzothiazol-3-yl]acetic acid |
| SMILES | COc1ccc2c(c1)N(CC(=O)O)/C(=C/c1sc3cc(Cl)sc3[n+]1CS(=O)(=O)O)S2 |
| InChI | InChI=1S/C17H13ClN2O6S4/c1-26-9-2-3-11-10(4-9)19(7-16(21)22)14(27-11)6-15-20(8-30(23,24)25)17-12(28-15)5-13(18)29-17/h2-6H,7-8H2,1H3,(H-,21,22,23,24,25)/p+1 |
| InChIKey | NBGKVOYMXQFPJI-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.03 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes3A(19)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|