About 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane
4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (PubChem CID 173499867) has the molecular formula C12H22O6
and a molecular weight of 262.30 g/mol. Its IUPAC name is 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| PubChem CID | 173499867 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane |
| SMILES | C(OCC1CO1)C1CO1.OCC=CC(CO)CO |
| InChI | InChI=1S/C6H10O3.C6H12O3/c1(5-3-8-5)7-2-6-4-9-6;7-3-1-2-6(4-8)5-9/h5-6H,1-4H2;1-2,6-9H,3-5H2 |
| InChIKey | JIQDMCJGUKWTLX-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The IUPAC name of 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane (CID 173499867) is 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane.
What is the SMILES notation for 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The canonical SMILES for 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane is C(OCC1CO1)C1CO1.OCC=CC(CO)CO.
What is the InChIKey of 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
The InChIKey is JIQDMCJGUKWTLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O3.C6H12O3/c1(5-3-8-5)7-2-6-4-9-6;7-3-1-2-6(4-8)5-9/h5-6H,1-4H2;1-2,6-9H,3-5H2.
What are the key properties of 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane?
4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane has a molecular weight of 262.30 g/mol, XLogP of -1.06, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)pent-2-ene-1,5-diol;2-(oxiran-2-ylmethoxymethyl)oxirane is sourced from PubChem (CID 173499867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).