C18H36O3Si — CID 173499972
tert-butyl-[(3S,4S,5R)-3,8-dimethoxy-5,7-dimethylocta-1,6-dien-4-yl]oxy-dimethylsilane (PubChem CID 173499972) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is tert-butyl-[(3S,4S,5R)-3,8-dimethoxy-5,7-dimethylocta-1,6-dien-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4S,5R)-3,8-dimethoxy-5,7-dimethylocta-1,6-dien-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 173499972 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | tert-butyl-[(3S,4S,5R)-3,8-dimethoxy-5,7-dimethylocta-1,6-dien-4-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=C(C)COC |
| InChI | InChI=1S/C18H36O3Si/c1-11-16(20-8)17(15(3)12-14(2)13-19-7)21-22(9,10)18(4,5)6/h11-12,15-17H,1,13H2,2-10H3/t15-,16+,17+/m1/s1 |
| InChIKey | BASZPCYAJJUHBJ-IKGGRYGDSA-N |
| XLogP | 4.81 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|