C19H20BrN3O3S — CID 17350375
5-bromo-2-butoxy-N-[(2-carbamoylphenyl)carbamothioyl]benzamide (PubChem CID 17350375) has the molecular formula C19H20BrN3O3S and a molecular weight of 450.36 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[(2-carbamoylphenyl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[(2-carbamoylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17350375 |
| Molecular Formula | C19H20BrN3O3S |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 5-bromo-2-butoxy-N-[(2-carbamoylphenyl)carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C19H20BrN3O3S/c1-2-3-10-26-16-9-8-12(20)11-14(16)18(25)23-19(27)22-15-7-5-4-6-13(15)17(21)24/h4-9,11H,2-3,10H2,1H3,(H2,21,24)(H2,22,23,25,27) |
| InChIKey | RFMLOSFUKUKGAF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|