C17H15BrCl3NO2 — CID 17351631
3-bromo-4-(2-methylpropoxy)-N-(2,4,5-trichlorophenyl)benzamide (PubChem CID 17351631) has the molecular formula C17H15BrCl3NO2 and a molecular weight of 451.58 g/mol. Its IUPAC name is 3-bromo-4-(2-methylpropoxy)-N-(2,4,5-trichlorophenyl)benzamide.
| Compound Name | 3-bromo-4-(2-methylpropoxy)-N-(2,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 17351631 |
| Molecular Formula | C17H15BrCl3NO2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 448.94 |
| IUPAC Name | 3-bromo-4-(2-methylpropoxy)-N-(2,4,5-trichlorophenyl)benzamide |
| SMILES | CC(C)COc1ccc(C(=O)Nc2cc(Cl)c(Cl)cc2Cl)cc1Br |
| InChI | InChI=1S/C17H15BrCl3NO2/c1-9(2)8-24-16-4-3-10(5-11(16)18)17(23)22-15-7-13(20)12(19)6-14(15)21/h3-7,9H,8H2,1-2H3,(H,22,23) |
| InChIKey | CMZYUBIUYQSIMA-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|