C17H22BrNO2 — CID 17351650
3-bromo-4-(2-methylpropoxy)-N,N-bis(prop-2-enyl)benzamide (PubChem CID 17351650) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is 3-bromo-4-(2-methylpropoxy)-N,N-bis(prop-2-enyl)benzamide.
| Compound Name | 3-bromo-4-(2-methylpropoxy)-N,N-bis(prop-2-enyl)benzamide |
|---|---|
| PubChem CID | 17351650 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 3-bromo-4-(2-methylpropoxy)-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(OCC(C)C)c(Br)c1 |
| InChI | InChI=1S/C17H22BrNO2/c1-5-9-19(10-6-2)17(20)14-7-8-16(15(18)11-14)21-12-13(3)4/h5-8,11,13H,1-2,9-10,12H2,3-4H3 |
| InChIKey | UJTHHNQAWBZWSZ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|