C18H26FN3 — CID 173518247
(8aS)-N,N-diethyl-2-[(2R)-2-fluoro-2H-pyridin-5-ylidene]-3,4,4a,5,8,8a-hexahydro-1H-quinolin-6-amine (PubChem CID 173518247) has the molecular formula C18H26FN3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (8aS)-N,N-diethyl-2-[(2R)-2-fluoro-2H-pyridin-5-ylidene]-3,4,4a,5,8,8a-hexahydro-1H-quinolin-6-amine.
| Compound Name | (8aS)-N,N-diethyl-2-[(2R)-2-fluoro-2H-pyridin-5-ylidene]-3,4,4a,5,8,8a-hexahydro-1H-quinolin-6-amine |
|---|---|
| PubChem CID | 173518247 |
| Molecular Formula | C18H26FN3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | (8aS)-N,N-diethyl-2-[(2R)-2-fluoro-2H-pyridin-5-ylidene]-3,4,4a,5,8,8a-hexahydro-1H-quinolin-6-amine |
| SMILES | CCN(CC)C1=CC[C@H]2C(C1)CCC(=C3C=C[C@H](N=C3)F)N2 |
| InChI | InChI=1S/C18H26FN3/c1-3-22(4-2)15-7-9-16-13(11-15)5-8-17(21-16)14-6-10-18(19)20-12-14/h6-7,10,12-13,16,18,21H,3-5,8-9,11H2,1-2H3/t13?,16-,18-/m0/s1 |
| InChIKey | BTNFVZQFXGGVKJ-DLJHKNHVSA-N |
| XLogP | 3.30 |
| TPSA | 27.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | 528 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|