C25H25BrN2O4 — CID 17351934
3-bromo-4-(2-methylpropoxy)-N'-(2-phenylmethoxybenzoyl)benzohydrazide (PubChem CID 17351934) has the molecular formula C25H25BrN2O4 and a molecular weight of 497.39 g/mol. Its IUPAC name is 3-bromo-4-(2-methylpropoxy)-N'-(2-phenylmethoxybenzoyl)benzohydrazide.
| Compound Name | 3-bromo-4-(2-methylpropoxy)-N'-(2-phenylmethoxybenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 17351934 |
| Molecular Formula | C25H25BrN2O4 |
| Molecular Weight | 497.39 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 3-bromo-4-(2-methylpropoxy)-N'-(2-phenylmethoxybenzoyl)benzohydrazide |
| SMILES | CC(C)COc1ccc(C(=O)NNC(=O)c2ccccc2OCc2ccccc2)cc1Br |
| InChI | InChI=1S/C25H25BrN2O4/c1-17(2)15-31-23-13-12-19(14-21(23)26)24(29)27-28-25(30)20-10-6-7-11-22(20)32-16-18-8-4-3-5-9-18/h3-14,17H,15-16H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | UICBAZIJMFYGJN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.39 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|