C20H23N3O5 — CID 17353591
N-[4-[[[4-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]propanamide (PubChem CID 17353591) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-[4-[[[4-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]propanamide.
| Compound Name | N-[4-[[[4-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 17353591 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[4-[[[4-(2-methoxyethoxy)benzoyl]amino]carbamoyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)NNC(=O)c2ccc(OCCOC)cc2)cc1 |
| InChI | InChI=1S/C20H23N3O5/c1-3-18(24)21-16-8-4-14(5-9-16)19(25)22-23-20(26)15-6-10-17(11-7-15)28-13-12-27-2/h4-11H,3,12-13H2,1-2H3,(H,21,24)(H,22,25)(H,23,26) |
| InChIKey | MAQBUVUUCIORER-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|