C11H15N5S3 — CID 17354893
2-[3,5-bis(1,3-thiazol-2-yl)-1,3,5-triazinan-1-yl]ethanethiol (PubChem CID 17354893) has the molecular formula C11H15N5S3 and a molecular weight of 313.48 g/mol. Its IUPAC name is 2-[3,5-bis(1,3-thiazol-2-yl)-1,3,5-triazinan-1-yl]ethanethiol.
| Compound Name | 2-[3,5-bis(1,3-thiazol-2-yl)-1,3,5-triazinan-1-yl]ethanethiol |
|---|---|
| PubChem CID | 17354893 |
| Molecular Formula | C11H15N5S3 |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-[3,5-bis(1,3-thiazol-2-yl)-1,3,5-triazinan-1-yl]ethanethiol |
| SMILES | SCCN1CN(c2nccs2)CN(c2nccs2)C1 |
| InChI | InChI=1S/C11H15N5S3/c17-4-3-14-7-15(10-12-1-5-18-10)9-16(8-14)11-13-2-6-19-11/h1-2,5-6,17H,3-4,7-9H2 |
| InChIKey | UKFPMEVVKVAPIH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|