C13H9ClFN3O2 — CID 17355008
5-chloro-2-(4-fluorophenyl)-6-methyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione (PubChem CID 17355008) has the molecular formula C13H9ClFN3O2 and a molecular weight of 293.69 g/mol. Its IUPAC name is 5-chloro-2-(4-fluorophenyl)-6-methyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione.
| Compound Name | 5-chloro-2-(4-fluorophenyl)-6-methyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
|---|---|
| PubChem CID | 17355008 |
| Molecular Formula | C13H9ClFN3O2 |
| Molecular Weight | 293.69 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 5-chloro-2-(4-fluorophenyl)-6-methyl-1,7-dihydropyrazolo[3,4-b]pyridine-3,4-dione |
| SMILES | Cc1[nH]c2[nH]n(-c3ccc(F)cc3)c(=O)c2c(=O)c1Cl |
| InChI | InChI=1S/C13H9ClFN3O2/c1-6-10(14)11(19)9-12(16-6)17-18(13(9)20)8-4-2-7(15)3-5-8/h2-5H,1H3,(H2,16,17,19) |
| InChIKey | DWIXKRLDEQFXOI-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.69 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|