C20H23N3O5S — CID 17356180
2-(2-methoxyethoxy)-N-[[[2-(4-methylphenoxy)acetyl]amino]carbamothioyl]benzamide (PubChem CID 17356180) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-[[[2-(4-methylphenoxy)acetyl]amino]carbamothioyl]benzamide.
| Compound Name | 2-(2-methoxyethoxy)-N-[[[2-(4-methylphenoxy)acetyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17356180 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-[[[2-(4-methylphenoxy)acetyl]amino]carbamothioyl]benzamide |
| SMILES | COCCOc1ccccc1C(=O)NC(=S)NNC(=O)COc1ccc(C)cc1 |
| InChI | InChI=1S/C20H23N3O5S/c1-14-7-9-15(10-8-14)28-13-18(24)22-23-20(29)21-19(25)16-5-3-4-6-17(16)27-12-11-26-2/h3-10H,11-13H2,1-2H3,(H,22,24)(H2,21,23,25,29) |
| InChIKey | VKPKIVIQBDRDSZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|