C21H23BrN2O4 — CID 17357287
5-bromo-2-(2-methoxyethoxy)-N-[2-(pyrrolidine-1-carbonyl)phenyl]benzamide (PubChem CID 17357287) has the molecular formula C21H23BrN2O4 and a molecular weight of 447.33 g/mol. Its IUPAC name is 5-bromo-2-(2-methoxyethoxy)-N-[2-(pyrrolidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 5-bromo-2-(2-methoxyethoxy)-N-[2-(pyrrolidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17357287 |
| Molecular Formula | C21H23BrN2O4 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 5-bromo-2-(2-methoxyethoxy)-N-[2-(pyrrolidine-1-carbonyl)phenyl]benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)Nc1ccccc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C21H23BrN2O4/c1-27-12-13-28-19-9-8-15(22)14-17(19)20(25)23-18-7-3-2-6-16(18)21(26)24-10-4-5-11-24/h2-3,6-9,14H,4-5,10-13H2,1H3,(H,23,25) |
| InChIKey | CVCRGNRZSKHTJB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|