C13H17N3O6 — CID 17357929
3-ethoxy-N'-[2-(2-nitrophenoxy)acetyl]propanehydrazide (PubChem CID 17357929) has the molecular formula C13H17N3O6 and a molecular weight of 311.29 g/mol. Its IUPAC name is 3-ethoxy-N'-[2-(2-nitrophenoxy)acetyl]propanehydrazide.
| Compound Name | 3-ethoxy-N'-[2-(2-nitrophenoxy)acetyl]propanehydrazide |
|---|---|
| PubChem CID | 17357929 |
| Molecular Formula | C13H17N3O6 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-ethoxy-N'-[2-(2-nitrophenoxy)acetyl]propanehydrazide |
| SMILES | CCOCCC(=O)NNC(=O)COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N3O6/c1-2-21-8-7-12(17)14-15-13(18)9-22-11-6-4-3-5-10(11)16(19)20/h3-6H,2,7-9H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | UAEOPFCIOAKLBA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|