C16H24N2O4 — CID 17357941
N'-(3-ethoxypropanoyl)-2-(2-methylpropoxy)benzohydrazide (PubChem CID 17357941) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is N'-(3-ethoxypropanoyl)-2-(2-methylpropoxy)benzohydrazide.
| Compound Name | N'-(3-ethoxypropanoyl)-2-(2-methylpropoxy)benzohydrazide |
|---|---|
| PubChem CID | 17357941 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N'-(3-ethoxypropanoyl)-2-(2-methylpropoxy)benzohydrazide |
| SMILES | CCOCCC(=O)NNC(=O)c1ccccc1OCC(C)C |
| InChI | InChI=1S/C16H24N2O4/c1-4-21-10-9-15(19)17-18-16(20)13-7-5-6-8-14(13)22-11-12(2)3/h5-8,12H,4,9-11H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | RIFTYKBOVBTZBF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|