About (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate
(3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate (PubChem CID 17360209) has the molecular formula C16H14ClNO5
and a molecular weight of 335.74 g/mol. Its IUPAC name is (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate.
Molecular Properties
| Compound Name | (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate |
| PubChem CID | 17360209 |
| Molecular Formula | C16H14ClNO5 |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate |
| SMILES | CCOc1ccc(Cl)cc1C(=O)Oc1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C16H14ClNO5/c1-3-22-15-7-4-11(17)9-13(15)16(19)23-12-5-6-14(18(20)21)10(2)8-12/h4-9H,3H2,1-2H3 |
| InChIKey | HVJVQWASJDQGPD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate?
The IUPAC name of (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate (CID 17360209) is (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate.
What is the SMILES notation for (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate?
The canonical SMILES for (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate is CCOc1ccc(Cl)cc1C(=O)Oc1ccc([N+](=O)[O-])c(C)c1.
What is the InChIKey of (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate?
The InChIKey is HVJVQWASJDQGPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNO5/c1-3-22-15-7-4-11(17)9-13(15)16(19)23-12-5-6-14(18(20)21)10(2)8-12/h4-9H,3H2,1-2H3.
What are the key properties of (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate?
(3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate has a molecular weight of 335.74 g/mol, XLogP of 4.17, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-4-nitrophenyl) 5-chloro-2-ethoxybenzoate is sourced from PubChem (CID 17360209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).