C22H26N2O4 — CID 17362172
N-[4-[(4-tert-butylbenzoyl)amino]-3-hydroxyphenyl]oxolane-2-carboxamide (PubChem CID 17362172) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[4-[(4-tert-butylbenzoyl)amino]-3-hydroxyphenyl]oxolane-2-carboxamide.
| Compound Name | N-[4-[(4-tert-butylbenzoyl)amino]-3-hydroxyphenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 17362172 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | N-[4-[(4-tert-butylbenzoyl)amino]-3-hydroxyphenyl]oxolane-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(NC(=O)C3CCCO3)cc2O)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-22(2,3)15-8-6-14(7-9-15)20(26)24-17-11-10-16(13-18(17)25)23-21(27)19-5-4-12-28-19/h6-11,13,19,25H,4-5,12H2,1-3H3,(H,23,27)(H,24,26) |
| InChIKey | IBAQXCQRYVRGDO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|