C23H24BF3N4O5 — CID 173625211
CID 173625211 (PubChem CID 173625211) has the molecular formula C23H24BF3N4O5 and a molecular weight of 504.30 g/mol.
| Compound Name | CID 173625211 |
|---|---|
| PubChem CID | 173625211 |
| Molecular Formula | C23H24BF3N4O5 |
| Molecular Weight | 504.30 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | — |
| SMILES | [B]C1=CN=C2C(=C1C(C3=CN=C(C=C3)C(F)(F)F)O)C(=O)N(C(=O)N2C)CCCOC4CCCCO4 |
| InChI | InChI=1S/C23H24BF3N4O5/c1-30-20-18(21(33)31(22(30)34)8-4-10-36-16-5-2-3-9-35-16)17(14(24)12-29-20)19(32)13-6-7-15(28-11-13)23(25,26)27/h6-7,11-12,16,19,32H,2-5,8-10H2,1H3 |
| InChIKey | QKEJDZSZHUEVFK-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 105.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | 793 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|