About 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide
5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide (PubChem CID 17365713) has the molecular formula C8H15BrN2S
and a molecular weight of 251.19 g/mol. Its IUPAC name is 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide.
Molecular Properties
| Compound Name | 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide |
| PubChem CID | 17365713 |
| Molecular Formula | C8H15BrN2S |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide |
| SMILES | CC1CNC(=[N+]2CCCC2)S1.[Br-] |
| InChI | InChI=1S/C8H14N2S.BrH/c1-7-6-9-8(11-7)10-4-2-3-5-10;/h7H,2-6H2,1H3;1H |
| InChIKey | YBTXBHPEMXILKJ-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide?
The IUPAC name of 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide (CID 17365713) is 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide.
What is the SMILES notation for 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide?
The canonical SMILES for 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide is CC1CNC(=[N+]2CCCC2)S1.[Br-].
What is the InChIKey of 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide?
The InChIKey is YBTXBHPEMXILKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2S.BrH/c1-7-6-9-8(11-7)10-4-2-3-5-10;/h7H,2-6H2,1H3;1H.
What are the key properties of 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide?
5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide has a molecular weight of 251.19 g/mol, XLogP of -2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-pyrrolidin-1-ium-1-ylidene-1,3-thiazolidine bromide is sourced from PubChem (CID 17365713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).