C22H28N2O9S — CID 17366089
1-(benzenesulfonyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;oxalic acid (PubChem CID 17366089) has the molecular formula C22H28N2O9S and a molecular weight of 496.54 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-(benzenesulfonyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 17366089 |
| Molecular Formula | C22H28N2O9S |
| Molecular Weight | 496.54 g/mol |
| Exact Mass | 496.15 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine;oxalic acid |
| SMILES | COc1cc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)cc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H26N2O5S.C2H2O4/c1-25-18-13-16(14-19(26-2)20(18)27-3)15-21-9-11-22(12-10-21)28(23,24)17-7-5-4-6-8-17;3-1(4)2(5)6/h4-8,13-14H,9-12,15H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | UORWECJQEDRIKD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.54 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|