C19H20BrN3O5 — CID 17366501
[4-[(2-bromophenyl)methyl]piperazin-1-yl]-pyridin-4-ylmethanone;oxalic acid (PubChem CID 17366501) has the molecular formula C19H20BrN3O5 and a molecular weight of 450.29 g/mol. Its IUPAC name is [4-[(2-bromophenyl)methyl]piperazin-1-yl]-pyridin-4-ylmethanone;oxalic acid.
| Compound Name | [4-[(2-bromophenyl)methyl]piperazin-1-yl]-pyridin-4-ylmethanone;oxalic acid |
|---|---|
| PubChem CID | 17366501 |
| Molecular Formula | C19H20BrN3O5 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | [4-[(2-bromophenyl)methyl]piperazin-1-yl]-pyridin-4-ylmethanone;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(c1ccncc1)N1CCN(Cc2ccccc2Br)CC1 |
| InChI | InChI=1S/C17H18BrN3O.C2H2O4/c18-16-4-2-1-3-15(16)13-20-9-11-21(12-10-20)17(22)14-5-7-19-8-6-14;3-1(4)2(5)6/h1-8H,9-13H2;(H,3,4)(H,5,6) |
| InChIKey | RRUFRZYLRUDFRF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 111.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|