C24H29F3N2O7 — CID 17367245
oxalic acid;1-[[2-(trifluoromethyl)phenyl]methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 17367245) has the molecular formula C24H29F3N2O7 and a molecular weight of 514.50 g/mol. Its IUPAC name is oxalic acid;1-[[2-(trifluoromethyl)phenyl]methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | oxalic acid;1-[[2-(trifluoromethyl)phenyl]methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 17367245 |
| Molecular Formula | C24H29F3N2O7 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | oxalic acid;1-[[2-(trifluoromethyl)phenyl]methyl]-4-[(3,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cc(CN2CCN(Cc3ccccc3C(F)(F)F)CC2)cc(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H27F3N2O3.C2H2O4/c1-28-19-12-16(13-20(29-2)21(19)30-3)14-26-8-10-27(11-9-26)15-17-6-4-5-7-18(17)22(23,24)25;3-1(4)2(5)6/h4-7,12-13H,8-11,14-15H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | ZPMNTEUXMXBKNI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|