C20H22BrFN2O5 — CID 17367378
4-bromo-2-[[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methyl]phenol;oxalic acid (PubChem CID 17367378) has the molecular formula C20H22BrFN2O5 and a molecular weight of 469.31 g/mol. Its IUPAC name is 4-bromo-2-[[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methyl]phenol;oxalic acid.
| Compound Name | 4-bromo-2-[[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methyl]phenol;oxalic acid |
|---|---|
| PubChem CID | 17367378 |
| Molecular Formula | C20H22BrFN2O5 |
| Molecular Weight | 469.31 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 4-bromo-2-[[4-[(3-fluorophenyl)methyl]piperazin-1-yl]methyl]phenol;oxalic acid |
| SMILES | O=C(O)C(=O)O.Oc1ccc(Br)cc1CN1CCN(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C18H20BrFN2O.C2H2O4/c19-16-4-5-18(23)15(11-16)13-22-8-6-21(7-9-22)12-14-2-1-3-17(20)10-14;3-1(4)2(5)6/h1-5,10-11,23H,6-9,12-13H2;(H,3,4)(H,5,6) |
| InChIKey | ZNHSYJHUWRWMHA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|