C17H17FN2O6 — CID 17367548
2-(3-fluorophenyl)-N-[(4-nitrophenyl)methyl]ethanamine;oxalic acid (PubChem CID 17367548) has the molecular formula C17H17FN2O6 and a molecular weight of 364.33 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[(4-nitrophenyl)methyl]ethanamine;oxalic acid.
| Compound Name | 2-(3-fluorophenyl)-N-[(4-nitrophenyl)methyl]ethanamine;oxalic acid |
|---|---|
| PubChem CID | 17367548 |
| Molecular Formula | C17H17FN2O6 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[(4-nitrophenyl)methyl]ethanamine;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=[N+]([O-])c1ccc(CNCCc2cccc(F)c2)cc1 |
| InChI | InChI=1S/C15H15FN2O2.C2H2O4/c16-14-3-1-2-12(10-14)8-9-17-11-13-4-6-15(7-5-13)18(19)20;3-1(4)2(5)6/h1-7,10,17H,8-9,11H2;(H,3,4)(H,5,6) |
| InChIKey | FACHPPYWBATLPW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|