N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid

C18H21NO5 — CID 17367859

IUPACN-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid
SMILESCOc1cccc(CNc2ccc(C)c(C)c2)c1.O=C(O)C(=O)O
InChIInChI=1S/C16H19NO.C2H2O4/c1-12-7-8-15(9-13(12)2)17-11-14-5-4-6-16(10-14)18-3;3-1(4)2(5)6/h4-10,17H,11H2,1-3H3;(H,3,4)(H,5,6)
InChIKeyPYFYCGQXHLIKHV-UHFFFAOYSA-N
MW331.37 g/mol
LogP3.08
Rot. Bonds4

About N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid

N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid (PubChem CID 17367859) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid.

Molecular Properties

Compound NameN-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid
PubChem CID17367859
Molecular FormulaC18H21NO5
Molecular Weight331.37 g/mol
Exact Mass331.14
IUPAC NameN-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid
SMILESCOc1cccc(CNc2ccc(C)c(C)c2)c1.O=C(O)C(=O)O
InChIInChI=1S/C16H19NO.C2H2O4/c1-12-7-8-15(9-13(12)2)17-11-14-5-4-6-16(10-14)18-3;3-1(4)2(5)6/h4-10,17H,11H2,1-3H3;(H,3,4)(H,5,6)
InChIKeyPYFYCGQXHLIKHV-UHFFFAOYSA-N
XLogP3.08
TPSA95.86 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.37
LogP ≤ 53.08
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid?
The IUPAC name of N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid (CID 17367859) is N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid.
What is the SMILES notation for N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid?
The canonical SMILES for N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid is COc1cccc(CNc2ccc(C)c(C)c2)c1.O=C(O)C(=O)O.
What is the InChIKey of N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid?
The InChIKey is PYFYCGQXHLIKHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO.C2H2O4/c1-12-7-8-15(9-13(12)2)17-11-14-5-4-6-16(10-14)18-3;3-1(4)2(5)6/h4-10,17H,11H2,1-3H3;(H,3,4)(H,5,6).
What are the key properties of N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid?
N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid has a molecular weight of 331.37 g/mol, XLogP of 3.08, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-methoxyphenyl)methyl]-3,4-dimethylaniline;oxalic acid is sourced from PubChem (CID 17367859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).