C23H28N4O5S2 — CID 17368541
2-amino-4,5-dimethylthiophene-3-carboxamide;3-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 17368541) has the molecular formula C23H28N4O5S2 and a molecular weight of 504.63 g/mol. Its IUPAC name is 2-amino-4,5-dimethylthiophene-3-carboxamide;3-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 2-amino-4,5-dimethylthiophene-3-carboxamide;3-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 17368541 |
| Molecular Formula | C23H28N4O5S2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.15 |
| IUPAC Name | 2-amino-4,5-dimethylthiophene-3-carboxamide;3-[(3-carbamoyl-4,5-dimethylthiophen-2-yl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | Cc1sc(N)c(C(N)=O)c1C.Cc1sc(NC(=O)C2C3C=CC(C3)C2C(=O)O)c(C(N)=O)c1C |
| InChI | InChI=1S/C16H18N2O4S.C7H10N2OS/c1-6-7(2)23-15(10(6)13(17)19)18-14(20)11-8-3-4-9(5-8)12(11)16(21)22;1-3-4(2)11-7(9)5(3)6(8)10/h3-4,8-9,11-12H,5H2,1-2H3,(H2,17,19)(H,18,20)(H,21,22);9H2,1-2H3,(H2,8,10) |
| InChIKey | MRJJBLAUWGMZSS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 178.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Aa(45)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|