C27H21NO5 — CID 17369632
(2-naphthalen-2-yl-2-oxoethyl) 4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate (PubChem CID 17369632) has the molecular formula C27H21NO5 and a molecular weight of 439.47 g/mol. Its IUPAC name is (2-naphthalen-2-yl-2-oxoethyl) 4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate.
| Compound Name | (2-naphthalen-2-yl-2-oxoethyl) 4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 17369632 |
| Molecular Formula | C27H21NO5 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (2-naphthalen-2-yl-2-oxoethyl) 4-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)C3CC=CCC3C2=O)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H21NO5/c29-24(20-10-9-17-5-1-2-6-19(17)15-20)16-33-27(32)18-11-13-21(14-12-18)28-25(30)22-7-3-4-8-23(22)26(28)31/h1-6,9-15,22-23H,7-8,16H2 |
| InChIKey | IKGBIZOIEGUCFO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|