C21H32N2O6 — CID 17369761
4-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2,6-dimethylmorpholine;oxalic acid (PubChem CID 17369761) has the molecular formula C21H32N2O6 and a molecular weight of 408.50 g/mol. Its IUPAC name is 4-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2,6-dimethylmorpholine;oxalic acid.
| Compound Name | 4-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2,6-dimethylmorpholine;oxalic acid |
|---|---|
| PubChem CID | 17369761 |
| Molecular Formula | C21H32N2O6 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 4-[1-[(3-methoxyphenyl)methyl]piperidin-4-yl]-2,6-dimethylmorpholine;oxalic acid |
| SMILES | COc1cccc(CN2CCC(N3CC(C)OC(C)C3)CC2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H30N2O2.C2H2O4/c1-15-12-21(13-16(2)23-15)18-7-9-20(10-8-18)14-17-5-4-6-19(11-17)22-3;3-1(4)2(5)6/h4-6,11,15-16,18H,7-10,12-14H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | KIJXSWWWRSWPML-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|