C27H46N2O2 — CID 17369942
1-cyclohexyl-3-[[(10R,13R,17R)-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]methyl]urea (PubChem CID 17369942) has the molecular formula C27H46N2O2 and a molecular weight of 430.68 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[(10R,13R,17R)-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]methyl]urea.
| Compound Name | 1-cyclohexyl-3-[[(10R,13R,17R)-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]methyl]urea |
|---|---|
| PubChem CID | 17369942 |
| Molecular Formula | C27H46N2O2 |
| Molecular Weight | 430.68 g/mol |
| Exact Mass | 430.36 |
| IUPAC Name | 1-cyclohexyl-3-[[(10R,13R,17R)-17-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-yl]methyl]urea |
| SMILES | C[C@@]12CCCCC1CCC1C2CC[C@]2(C)C1CC[C@]2(O)CNC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C27H46N2O2/c1-25-15-7-6-8-19(25)11-12-21-22(25)13-16-26(2)23(21)14-17-27(26,31)18-28-24(30)29-20-9-4-3-5-10-20/h19-23,31H,3-18H2,1-2H3,(H2,28,29,30)/t19?,21?,22?,23?,25-,26-,27+/m1/s1 |
| InChIKey | GAHNISWOWREBNY-MVUNVNANSA-N |
| XLogP | 5.78 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |