About N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride
N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride (PubChem CID 17371091) has the molecular formula C12H16Cl3NO
and a molecular weight of 296.62 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride |
| PubChem CID | 17371091 |
| Molecular Formula | C12H16Cl3NO |
| Molecular Weight | 296.62 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride |
| SMILES | Cl.Clc1ccc(CNCC2CCCO2)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO.ClH/c13-10-4-3-9(12(14)6-10)7-15-8-11-2-1-5-16-11;/h3-4,6,11,15H,1-2,5,7-8H2;1H |
| InChIKey | STLSOQKIOIXNPA-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.62 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride?
The IUPAC name of N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride (CID 17371091) is N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride.
What is the SMILES notation for N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride?
The canonical SMILES for N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride is Cl.Clc1ccc(CNCC2CCCO2)c(Cl)c1.
What is the InChIKey of N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride?
The InChIKey is STLSOQKIOIXNPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2NO.ClH/c13-10-4-3-9(12(14)6-10)7-15-8-11-2-1-5-16-11;/h3-4,6,11,15H,1-2,5,7-8H2;1H.
What are the key properties of N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride?
N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride has a molecular weight of 296.62 g/mol, XLogP of 3.68, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dichlorophenyl)methyl]-1-(oxolan-2-yl)methanamine;hydrochloride is sourced from PubChem (CID 17371091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).