C19H19Cl2N3OS — CID 17371650
3-[3-(4-chloro-2-methylphenoxy)propyl]-4-(3-chloro-4-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 17371650) has the molecular formula C19H19Cl2N3OS and a molecular weight of 408.35 g/mol. Its IUPAC name is 3-[3-(4-chloro-2-methylphenoxy)propyl]-4-(3-chloro-4-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[3-(4-chloro-2-methylphenoxy)propyl]-4-(3-chloro-4-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 17371650 |
| Molecular Formula | C19H19Cl2N3OS |
| Molecular Weight | 408.35 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | 3-[3-(4-chloro-2-methylphenoxy)propyl]-4-(3-chloro-4-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(-n2c(CCCOc3ccc(Cl)cc3C)n[nH]c2=S)cc1Cl |
| InChI | InChI=1S/C19H19Cl2N3OS/c1-12-5-7-15(11-16(12)21)24-18(22-23-19(24)26)4-3-9-25-17-8-6-14(20)10-13(17)2/h5-8,10-11H,3-4,9H2,1-2H3,(H,23,26) |
| InChIKey | HSXCCXNQBSHEKY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.35 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|