C7H15N3OS — CID 17372233
1-acetamido-3-(2-methylpropyl)thiourea (PubChem CID 17372233) has the molecular formula C7H15N3OS and a molecular weight of 189.28 g/mol. Its IUPAC name is 1-acetamido-3-(2-methylpropyl)thiourea.
| Compound Name | 1-acetamido-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 17372233 |
| Molecular Formula | C7H15N3OS |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 1-acetamido-3-(2-methylpropyl)thiourea |
| SMILES | CC(=O)NNC(=S)NCC(C)C |
| InChI | InChI=1S/C7H15N3OS/c1-5(2)4-8-7(12)10-9-6(3)11/h5H,4H2,1-3H3,(H,9,11)(H2,8,10,12) |
| InChIKey | HXCPXCBZZCZRNE-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|