C25H30N4O3S — CID 17373012
N-[3-[(2-ethoxyphenyl)carbamoyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl]-1-ethylpyrazole-3-carboxamide (PubChem CID 17373012) has the molecular formula C25H30N4O3S and a molecular weight of 466.61 g/mol. Its IUPAC name is N-[3-[(2-ethoxyphenyl)carbamoyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl]-1-ethylpyrazole-3-carboxamide.
| Compound Name | N-[3-[(2-ethoxyphenyl)carbamoyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 17373012 |
| Molecular Formula | C25H30N4O3S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | N-[3-[(2-ethoxyphenyl)carbamoyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)c1c(NC(=O)c2ccn(CC)n2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C25H30N4O3S/c1-3-29-16-15-19(28-29)23(30)27-25-22(17-11-7-5-6-8-14-21(17)33-25)24(31)26-18-12-9-10-13-20(18)32-4-2/h9-10,12-13,15-16H,3-8,11,14H2,1-2H3,(H,26,31)(H,27,30) |
| InChIKey | KYJNJCHPFPBHRL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |