C27H25ClN4O — CID 17373844
N-(1-benzylpiperidin-4-yl)-6-chloro-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 17373844) has the molecular formula C27H25ClN4O and a molecular weight of 456.98 g/mol. Its IUPAC name is N-(1-benzylpiperidin-4-yl)-6-chloro-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-(1-benzylpiperidin-4-yl)-6-chloro-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 17373844 |
| Molecular Formula | C27H25ClN4O |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-(1-benzylpiperidin-4-yl)-6-chloro-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1cc(-c2cccnc2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C27H25ClN4O/c28-21-8-9-25-23(15-21)24(16-26(31-25)20-7-4-12-29-17-20)27(33)30-22-10-13-32(14-11-22)18-19-5-2-1-3-6-19/h1-9,12,15-17,22H,10-11,13-14,18H2,(H,30,33) |
| InChIKey | UVUCEFFMTRFLDP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |